Are you an EPFL student looking for a semester project?
Work with us on data science and visualisation projects, and deploy your project as an app on top of Graph Search.
Concept
Edoxaban
Summary
Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 415900881
| drug_name =
| INN =
| type =
| image = Edoxaban.svg
| width = 275
| alt =
| caption =
| pronounce =
| tradename = Savaysa, Lixiana, Roteas, others
| Drugs.com =
| MedlinePlus = a614055
| licence_EU = yes
| DailyMedID = Edoxaban
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_US = N
| pregnancy_US_comment =
| pregnancy_category =
| routes_of_administration = By mouth
| class =
| ATC_prefix = B01
| ATC_suffix = AF03
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_EU = Rx-only
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Rx-only
| bioavailability = 62%; Tmax 1–2 hours
| protein_bound = 55%
| metabolism = minimal CES1, CYP3A4/5, hydrolysis, glucuronidation
| elimination_half-life = 10–14 hours
| excretion = 62% feces, 35% urine
| CAS_number_Ref =
| CAS_number = 480449-70-5
| PubChem = 10280735
| IUPHAR_ligand = 7575
| DrugBank_Ref =
| DrugBank = DB09075
| ChemSpiderID_Ref =
| ChemSpiderID = 8456212
| UNII_Ref =
| UNII = NDU3J18APO
| KEGG_Ref =
| KEGG = D09710
| ChEBI_Ref =
| ChEBI = 85973
| ChEMBL_Ref =
| ChEMBL =
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = DU-176b
| IUPAC_name = ''N-(5-chloropyridin-2-yl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide
| C=24 | H=30 | Cl=1 | N=7 | O=4 | S=1
| smiles = CN1CCC2=C(C1)SC(=N2)C(=O)N[C@@H]3CC@HC(=O)N(C)C
| StdInChI_Ref =
| StdInChI = 1S/C24H30ClN7O4S/c1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23/h5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34)/t13-,15-,17+/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = HGVDHZBSSITLCT-JLJPHGGASA-N
Edoxaban, sold under the brand name Lixiana''' among others, is an anticoagulant medication and a direct factor Xa inhibitor.
Official source
About this result
This page is automatically generated and may contain information that is not correct, complete, up-to-date, or relevant to your search query. The same applies to every other page on this website. Please make sure to verify the information with EPFL's official sources.