Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 415900881 | drug_name = | INN = | type = | image = Edoxaban.svg | width = 275 | alt = | caption = | pronounce = | tradename = Savaysa, Lixiana, Roteas, others | Drugs.com = | MedlinePlus = a614055 | licence_EU = yes | DailyMedID = Edoxaban | pregnancy_AU = | pregnancy_AU_comment = | pregnancy_US = N | pregnancy_US_comment = | pregnancy_category = | routes_of_administration = By mouth | class = | ATC_prefix = B01 | ATC_suffix = AF03 | legal_AU = | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | legal_UN = | legal_UN_comment = | legal_status = Rx-only | bioavailability = 62%; Tmax 1–2 hours | protein_bound = 55% | metabolism = minimal CES1, CYP3A4/5, hydrolysis, glucuronidation | elimination_half-life = 10–14 hours | excretion = 62% feces, 35% urine | CAS_number_Ref = | CAS_number = 480449-70-5 | PubChem = 10280735 | IUPHAR_ligand = 7575 | DrugBank_Ref = | DrugBank = DB09075 | ChemSpiderID_Ref = | ChemSpiderID = 8456212 | UNII_Ref = | UNII = NDU3J18APO | KEGG_Ref = | KEGG = D09710 | ChEBI_Ref = | ChEBI = 85973 | ChEMBL_Ref = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = DU-176b | IUPAC_name = ''N-(5-chloropyridin-2-yl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide | C=24 | H=30 | Cl=1 | N=7 | O=4 | S=1 | smiles = CN1CCC2=C(C1)SC(=N2)C(=O)N[C@@H]3CC@HC(=O)N(C)C | StdInChI_Ref = | StdInChI = 1S/C24H30ClN7O4S/c1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23/h5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34)/t13-,15-,17+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = HGVDHZBSSITLCT-JLJPHGGASA-N Edoxaban, sold under the brand name Lixiana''' among others, is an anticoagulant medication and a direct factor Xa inhibitor.

About this result
This page is automatically generated and may contain information that is not correct, complete, up-to-date, or relevant to your search query. The same applies to every other page on this website. Please make sure to verify the information with EPFL's official sources.
Related lectures (1)
The Spike-Wigner model
Explores the Spike-Wigner model, low-rank matrix factorization, and Gaussian matrices.
Related concepts (12)
Factor V
Factor V (pronounced factor five) is a protein of the coagulation system, rarely referred to as proaccelerin or labile factor. In contrast to most other coagulation factors, it is not enzymatically active but functions as a cofactor. Deficiency leads to predisposition for hemorrhage, while some mutations (most notably factor V Leiden) predispose for thrombosis. The gene for factor V is located on the first chromosome (1q24). It is genomically related to the family of multicopper oxidases, and is homologous to coagulation factor VIII.
Bayer
Bayer AG (ˈbaɪ.ər, commonly pronounced ˈbeɪər; ˈbaɪɐ) is a German multinational pharmaceutical and biotechnology company and is one of the largest pharmaceutical companies in the world. Headquartered in Leverkusen, Bayer's areas of business include pharmaceuticals, consumer healthcare products, agricultural chemicals, seeds and biotechnology products. The company is a component of the EURO STOXX 50 stock market index. Bayer was founded in 1863 in Barmen as a partnership between dye salesman Friedrich Bayer (1825–1880) and dyer Friedrich Weskott (1821–1876).
Rivaroxaban
Rivaroxaban, sold under the brand name Xarelto among others, is an anticoagulant medication (blood thinner) used to treat and prevent blood clots. Specifically it is used to treat deep vein thrombosis and pulmonary emboli and prevent blood clots in atrial fibrillation and following hip or knee surgery. It is taken by mouth. Common side effects include bleeding. Other serious side effects may include spinal hematoma and anaphylaxis. It is unclear if use in pregnancy and breastfeeding is safe.
Show more

Graph Chatbot

Chat with Graph Search

Ask any question about EPFL courses, lectures, exercises, research, news, etc. or try the example questions below.

DISCLAIMER: The Graph Chatbot is not programmed to provide explicit or categorical answers to your questions. Rather, it transforms your questions into API requests that are distributed across the various IT services officially administered by EPFL. Its purpose is solely to collect and recommend relevant references to content that you can explore to help you answer your questions.