Are you an EPFL student looking for a semester project?
Work with us on data science and visualisation projects, and deploy your project as an app on top of Graph Search.
Concept
Ranitidine
Summary
Drugbox
|Verifiedfields = changed
|Watchedfields = changed
|verifiedrevid = 458460406
|image = Ranitidine.svg
|width = 250
|image2 = File:Ranitidine-A-3D-balls.png
|JAN = ranitidine hydrochloride
|tradename = Zantac, others
|Drugs.com =
|MedlinePlus = a601106
|licence_CA =
|licence_EU =
|DailyMedID = Ranitidine
|licence_US = Ranitidine
|pregnancy_AU = B1
|pregnancy_AU_comment =
|routes_of_administration = By mouth, intravenous (IV)
|class = Histamine H2 receptor antagonist, aka H2 blocker
|ATC_prefix = A02
|ATC_suffix = BA02
|ATC_supplemental = (ranitidine bismuth citrate)
|legal_AU = S4
|legal_AU_comment = / S2 (Pharmacy Medicine)
|legal_BR =
|legal_CA =
|legal_DE =
|legal_NZ =
|legal_UK = POM
|legal_UK_comment = / GSL (General sales list)
|legal_US = Rx-only
|legal_US_comment = / OTC
|legal_EU = Rx-only
|legal_UN =
|bioavailability = 50% (by mouth)
|protein_bound = 15%
|metabolism = Liver: FMOs, including FMO3; other enzymes
|onset = 55–65 minutes (150 mg dose)55–115 minutes (75 mg dose)
|elimination_half-life = 2–3 hours
|duration_of_action =
|excretion = 30–70% kidney
|index2_label = HCl
|CAS_number_Ref =
|CAS_number = 66357-35-5
|CAS_number2_Ref =
|CAS_number2 = 66357-59-3
|PubChem = 3001055
|PubChem2 = 3033332
|IUPHAR_ligand = 1234
|DrugBank_Ref =
|DrugBank = DB00863
|DrugBank2_Ref =
|DrugBank2 = DBSALT000487
|ChemSpiderID_Ref =
|ChemSpiderID = 4863
|ChemSpiderID2_Ref =
|ChemSpiderID2 = 43590
|UNII_Ref =
|UNII = 884KT10YB7
|UNII2_Ref =
|UNII2 = BK76465IHM
|KEGG_Ref =
|KEGG = D00422
|KEGG2_Ref =
|KEGG2 = D00673
|ChEBI_Ref =
|ChEBI = 8776
|ChEBI2_Ref =
|ChEBI2 = 8777
|ChEMBL_Ref =
|ChEMBL = 1790041
|ChEMBL2_Ref =
|ChEMBL2 = 2110372
|synonyms = Dimethyl [(5-{[(2-{[1-(methylamino)-2-nitroethenyl]amino}ethyl)sulfanyl]methyl}furan-2-yl)methyl]amine
|IUPAC_name = N-(2-[(5-[(Dimethylamino)methyl]furan-2-yl)methylthio]ethyl)-''N-methyl-2-nitroethene-1,1-diamine
|C = 13 | H = 22 | N = 4 | O = 3 | S = 1
|SMILES = CNC(=CN+[O-])NCCSCC1=CC=C(O1)CN(C)C
|StdInChI_Ref =
|StdInChI = 1S/C13H22N4O3S/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3
|StdInChIKey_Ref =
|StdInChIKey = VMXUWOKSQNHOCA-UHFFFAOYSA-N
Ranitidine, sold under the brand name Zantac among others, is a medication used to decrease stomach acid production.
Official source
About this result
This page is automatically generated and may contain information that is not correct, complete, up-to-date, or relevant to your search query. The same applies to every other page on this website. Please make sure to verify the information with EPFL's official sources.