Are you an EPFL student looking for a semester project?
Work with us on data science and visualisation projects, and deploy your project as an app on top of GraphSearch.
Concept
Chloroquine
Summary
Infobox drug
| Watchedfields = changed
| verifiedrevid = 459442331
| drug_name =
| INN =
| type =
| image = Chloroquine.svg
| width = 200
| alt =
| image2 = Chloroquine-ligand-CLQ-A-from-PDB-xtal-4FGL-Mercury-3D-balls.png
| width2 = 180
| alt2 =
| caption =
| pronounce = ˈklɔːrəkwiːn
| tradename = Aralen, other
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID = Chloroquine
| licence_US = Chloroquine
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_US =
| pregnancy_US_comment =
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = by mouth
| class =
| ATCvet =
| ATC_prefix = P01
| ATC_suffix = BA01
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK = P
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Rx only
| bioavailability =
| protein_bound =
| metabolism = Liver
| metabolites =
| onset =
| elimination_half-life = 1-2 months
| duration_of_action =
| excretion =
| CAS_number_Ref =
| CAS_number = 54-05-7
| CAS_supplemental =
| PubChem = 2719
| IUPHAR_ligand = 5535
| DrugBank_Ref =
| DrugBank = DB00608
| ChemSpiderID_Ref =
| ChemSpiderID = 2618
| UNII_Ref =
| UNII = 886U3H6UFF
| KEGG_Ref =
| KEGG = D02366
| ChEBI_Ref =
| ChEBI = 3638
| ChEMBL_Ref =
| ChEMBL = 76
| NIAID_ChemDB = 000733
| PDB_ligand =
| synonyms = Chloroquine phosphate
| IUPAC_name = (RS)-N-(7-chloroquinolin-4-yl)-N,N-diethyl-pentane-1,4-diamine
| C=18 | H=26 | Cl=1 | N=3
| SMILES = Clc1cc2nccc(c2cc1)NC(C)CCCN(CC)CC
| Jmol =
| StdInChI_Ref =
| StdInChI = 1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21)
| StdInChI_comment =
| StdInChIKey_Ref =
| StdInChIKey = WHTVZRBIWZFKQO-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
Chloroquine''' is a medication primarily used to prevent and treat malaria in areas where malaria remains sensitive to its effects.
Official source
About this result
This page is automatically generated and may contain information that is not correct, complete, up-to-date, or relevant to your search query. The same applies to every other page on this website. Please make sure to verify the information with EPFL's official sources.